C23H30Hf-2 — CID 154430208
1,3-dimethyl-1,2-dihydroinden-2-ide;hafnium;1,2,3,4-tetramethyl-5-propylcyclopenta-1,3-diene (PubChem CID 154430208) has the molecular formula C23H30Hf-2 and a molecular weight of 484.98 g/mol. Its IUPAC name is 1,3-dimethyl-1,2-dihydroinden-2-ide;hafnium;1,2,3,4-tetramethyl-5-propylcyclopenta-1,3-diene.
| Compound Name | 1,3-dimethyl-1,2-dihydroinden-2-ide;hafnium;1,2,3,4-tetramethyl-5-propylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154430208 |
| Molecular Formula | C23H30Hf-2 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1,3-dimethyl-1,2-dihydroinden-2-ide;hafnium;1,2,3,4-tetramethyl-5-propylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]C(C)c2ccccc21.CCC[c-]1c(C)c(C)c(C)c1C.[Hf] |
| InChI | InChI=1S/C12H19.C11H11.Hf/c1-6-7-12-10(4)8(2)9(3)11(12)5;1-8-7-9(2)11-6-4-3-5-10(8)11;/h6-7H2,1-5H3;3-6,8H,1-2H3;/q2*-1; |
| InChIKey | SJPIJAIBERNMOG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|