About methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate
methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate (PubChem CID 154430523) has the molecular formula C13H17F2NO3S
and a molecular weight of 305.35 g/mol. Its IUPAC name is methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 154430523 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate |
| SMILES | COCc1nc(C2CCCC(F)(F)C2)sc1C(=O)OC |
| InChI | InChI=1S/C13H17F2NO3S/c1-18-7-9-10(12(17)19-2)20-11(16-9)8-4-3-5-13(14,15)6-8/h8H,3-7H2,1-2H3 |
| InChIKey | XPZVQSWJFQIIFC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate (CID 154430523) is methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate is COCc1nc(C2CCCC(F)(F)C2)sc1C(=O)OC.
What is the InChIKey of methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate?
The InChIKey is XPZVQSWJFQIIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO3S/c1-18-7-9-10(12(17)19-2)20-11(16-9)8-4-3-5-13(14,15)6-8/h8H,3-7H2,1-2H3.
What are the key properties of methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate?
methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate has a molecular weight of 305.35 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-difluorocyclohexyl)-4-(methoxymethyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 154430523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).