C8H6F5N3O — CID 154430664
N'-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboximidamide (PubChem CID 154430664) has the molecular formula C8H6F5N3O and a molecular weight of 255.15 g/mol. Its IUPAC name is N'-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 154430664 |
| Molecular Formula | C8H6F5N3O |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N'-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cc(C(F)(F)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C8H6F5N3O/c9-7(10,8(11,12)13)4-1-2-15-5(3-4)6(14)16-17/h1-3,17H,(H2,14,16) |
| InChIKey | RCFPKFZERQHORD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|