About 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane
2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane (PubChem CID 154431243) has the molecular formula C11H20O2Si
and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane |
| PubChem CID | 154431243 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane |
| SMILES | CCO[SiH](CCC1C=CC=C1)OCC |
| InChI | InChI=1S/C11H20O2Si/c1-3-12-14(13-4-2)10-9-11-7-5-6-8-11/h5-8,11,14H,3-4,9-10H2,1-2H3 |
| InChIKey | ILKHRFWQRDHMMB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane (CID 154431243) is 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane is CCO[SiH](CCC1C=CC=C1)OCC.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane?
The InChIKey is ILKHRFWQRDHMMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2Si/c1-3-12-14(13-4-2)10-9-11-7-5-6-8-11/h5-8,11,14H,3-4,9-10H2,1-2H3.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane?
2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane has a molecular weight of 212.36 g/mol, XLogP of 2.41, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylethyl(diethoxy)silane is sourced from PubChem (CID 154431243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).