C17H24Hf-2 — CID 154431533
hafnium;5-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene (PubChem CID 154431533) has the molecular formula C17H24Hf-2 and a molecular weight of 406.87 g/mol. Its IUPAC name is hafnium;5-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene.
| Compound Name | hafnium;5-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154431533 |
| Molecular Formula | C17H24Hf-2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | hafnium;5-propylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene |
| SMILES | CCC[c-]1cccc1.Cc1c[c-](C)c(C)c1C.[Hf] |
| InChI | InChI=1S/C9H13.C8H11.Hf/c1-6-5-7(2)9(4)8(6)3;1-2-5-8-6-3-4-7-8;/h5H,1-4H3;3-4,6-7H,2,5H2,1H3;/q2*-1; |
| InChIKey | OOQHUBZIBJPTTM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|