C6H4F5O2- — CID 154432179
3,3,5,5,5-pentafluoro-2-methylidenepentanoate (PubChem CID 154432179) has the molecular formula C6H4F5O2- and a molecular weight of 203.09 g/mol. Its IUPAC name is 3,3,5,5,5-pentafluoro-2-methylidenepentanoate.
| Compound Name | 3,3,5,5,5-pentafluoro-2-methylidenepentanoate |
|---|---|
| PubChem CID | 154432179 |
| Molecular Formula | C6H4F5O2- |
| Molecular Weight | 203.09 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | 3,3,5,5,5-pentafluoro-2-methylidenepentanoate |
| SMILES | C=C(C(=O)[O-])C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C6H5F5O2/c1-3(4(12)13)5(7,8)2-6(9,10)11/h1-2H2,(H,12,13)/p-1 |
| InChIKey | NPACHCFVAUCTOB-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.09 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|