C21H22N4O3S — CID 154433499
methyl 4-[[2-(2-aminophenyl)sulfanylacetyl]amino]-1-(1-phenylethyl)pyrazole-3-carboxylate (PubChem CID 154433499) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 4-[[2-(2-aminophenyl)sulfanylacetyl]amino]-1-(1-phenylethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-[[2-(2-aminophenyl)sulfanylacetyl]amino]-1-(1-phenylethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154433499 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | methyl 4-[[2-(2-aminophenyl)sulfanylacetyl]amino]-1-(1-phenylethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C(C)c2ccccc2)cc1NC(=O)CSc1ccccc1N |
| InChI | InChI=1S/C21H22N4O3S/c1-14(15-8-4-3-5-9-15)25-12-17(20(24-25)21(27)28-2)23-19(26)13-29-18-11-7-6-10-16(18)22/h3-12,14H,13,22H2,1-2H3,(H,23,26) |
| InChIKey | QUFDJAMXLQKHAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|