About cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine
cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine (PubChem CID 154434293) has the molecular formula C26H19Cl2NSZr
and a molecular weight of 539.64 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine |
| PubChem CID | 154434293 |
| Molecular Formula | C26H19Cl2NSZr |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 536.97 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine |
| SMILES | Cl[Zr+2]Cl.c1cc[cH-]c1.c1ccc2c(c1)Sc1ccccc1N2c1cc2ccccc2[cH-]1 |
| InChI | InChI=1S/C21H14NS.C5H5.2ClH.Zr/c1-2-8-16-14-17(13-15(16)7-1)22-18-9-3-5-11-20(18)23-21-12-6-4-10-19(21)22;1-2-4-5-3-1;;;/h1-14H;1-5H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | NDIQEESQKGSRJJ-UHFFFAOYSA-L |
| XLogP | 9.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine?
The IUPAC name of cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine (CID 154434293) is cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine.
What is the SMILES notation for cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine?
The canonical SMILES for cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine is Cl[Zr+2]Cl.c1cc[cH-]c1.c1ccc2c(c1)Sc1ccccc1N2c1cc2ccccc2[cH-]1.
What is the InChIKey of cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine?
The InChIKey is NDIQEESQKGSRJJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H14NS.C5H5.2ClH.Zr/c1-2-8-16-14-17(13-15(16)7-1)22-18-9-3-5-11-20(18)23-21-12-6-4-10-19(21)22;1-2-4-5-3-1;;;/h1-14H;1-5H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine?
cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine has a molecular weight of 539.64 g/mol, XLogP of 9.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dichlorozirconium(2+);10-(1H-inden-1-id-2-yl)phenothiazine is sourced from PubChem (CID 154434293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).