About cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole
cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole (PubChem CID 154434331) has the molecular formula C24H21F2NZr
and a molecular weight of 452.66 g/mol. Its IUPAC name is cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole |
| PubChem CID | 154434331 |
| Molecular Formula | C24H21F2NZr |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole |
| SMILES | Cc1c(C)n(-c2cc3ccccc3[cH-]2)c2ccccc12.F[Zr+2]F.c1cc[cH-]c1 |
| InChI | InChI=1S/C19H16N.C5H5.2FH.Zr/c1-13-14(2)20(19-10-6-5-9-18(13)19)17-11-15-7-3-4-8-16(15)12-17;1-2-4-5-3-1;;;/h3-12H,1-2H3;1-5H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | SVIBNORYEWZLOG-UHFFFAOYSA-L |
| XLogP | 7.36 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole?
The IUPAC name of cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole (CID 154434331) is cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole.
What is the SMILES notation for cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole?
The canonical SMILES for cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole is Cc1c(C)n(-c2cc3ccccc3[cH-]2)c2ccccc12.F[Zr+2]F.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole?
The InChIKey is SVIBNORYEWZLOG-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H16N.C5H5.2FH.Zr/c1-13-14(2)20(19-10-6-5-9-18(13)19)17-11-15-7-3-4-8-16(15)12-17;1-2-4-5-3-1;;;/h3-12H,1-2H3;1-5H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole?
cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole has a molecular weight of 452.66 g/mol, XLogP of 7.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;difluorozirconium(2+);1-(1H-inden-1-id-2-yl)-2,3-dimethylindole is sourced from PubChem (CID 154434331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).