C12H16BrFO3 — CID 154437871
4-[(1-bromo-5-fluorocyclohexa-2,4-dien-1-yl)oxymethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 154437871) has the molecular formula C12H16BrFO3 and a molecular weight of 307.16 g/mol. Its IUPAC name is 4-[(1-bromo-5-fluorocyclohexa-2,4-dien-1-yl)oxymethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[(1-bromo-5-fluorocyclohexa-2,4-dien-1-yl)oxymethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 154437871 |
| Molecular Formula | C12H16BrFO3 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-[(1-bromo-5-fluorocyclohexa-2,4-dien-1-yl)oxymethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(COC2(Br)C=CC=C(F)C2)O1 |
| InChI | InChI=1S/C12H16BrFO3/c1-11(2)15-7-10(17-11)8-16-12(13)5-3-4-9(14)6-12/h3-5,10H,6-8H2,1-2H3 |
| InChIKey | PDGVIYOOONFXJQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|