About 4,5-dihydro-1H-indene
4,5-dihydro-1H-indene (PubChem CID 15443952) has the molecular formula C9H10
and a molecular weight of 118.18 g/mol. Its IUPAC name is 4,5-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-indene |
| PubChem CID | 15443952 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 4,5-dihydro-1H-indene |
| SMILES | C1=CC2=C(C=CC2)CC1 |
| InChI | InChI=1S/C9H10/c1-2-5-9-7-3-6-8(9)4-1/h1,3-4,7H,2,5-6H2 |
| InChIKey | XJYMGBPJWDAMFO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,5-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-indene?
The IUPAC name of 4,5-dihydro-1H-indene (CID 15443952) is 4,5-dihydro-1H-indene.
What is the SMILES notation for 4,5-dihydro-1H-indene?
The canonical SMILES for 4,5-dihydro-1H-indene is C1=CC2=C(C=CC2)CC1.
What is the InChIKey of 4,5-dihydro-1H-indene?
The InChIKey is XJYMGBPJWDAMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10/c1-2-5-9-7-3-6-8(9)4-1/h1,3-4,7H,2,5-6H2.
What are the key properties of 4,5-dihydro-1H-indene?
4,5-dihydro-1H-indene has a molecular weight of 118.18 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-indene is sourced from PubChem (CID 15443952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).