About 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium
3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium (PubChem CID 154439858) has the molecular formula C15H29NO4P+
and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium.
Molecular Properties
| Compound Name | 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium |
| PubChem CID | 154439858 |
| Molecular Formula | C15H29NO4P+ |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium |
| SMILES | CCCCOC(=O)N[C@@H]1CC[C@H](CCC[P+](=O)OCC)C1 |
| InChI | InChI=1S/C15H28NO4P/c1-3-5-10-19-15(17)16-14-9-8-13(12-14)7-6-11-21(18)20-4-2/h13-14H,3-12H2,1-2H3/p+1/t13-,14+/m0/s1 |
| InChIKey | ZICVHUDKKMEYNV-UONOGXRCSA-O |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium?
The IUPAC name of 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium (CID 154439858) is 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium.
What is the SMILES notation for 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium?
The canonical SMILES for 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium is CCCCOC(=O)N[C@@H]1CC[C@H](CCC[P+](=O)OCC)C1.
What is the InChIKey of 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium?
The InChIKey is ZICVHUDKKMEYNV-UONOGXRCSA-O. The full InChI is InChI=1S/C15H28NO4P/c1-3-5-10-19-15(17)16-14-9-8-13(12-14)7-6-11-21(18)20-4-2/h13-14H,3-12H2,1-2H3/p+1/t13-,14+/m0/s1.
What are the key properties of 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium?
3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium has a molecular weight of 318.37 g/mol, XLogP of 4.24, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium is sourced from PubChem (CID 154439858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).