C15H29NO4P+ — CID 154439858
3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium (PubChem CID 154439858) has the molecular formula C15H29NO4P+ and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium.
| Compound Name | 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 154439858 |
| Molecular Formula | C15H29NO4P+ |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[(1R,3R)-3-(butoxycarbonylamino)cyclopentyl]propyl-ethoxy-oxophosphanium |
| SMILES | CCCCOC(=O)N[C@@H]1CC[C@H](CCC[P+](=O)OCC)C1 |
| InChI | InChI=1S/C15H28NO4P/c1-3-5-10-19-15(17)16-14-9-8-13(12-14)7-6-11-21(18)20-4-2/h13-14H,3-12H2,1-2H3/p+1/t13-,14+/m0/s1 |
| InChIKey | ZICVHUDKKMEYNV-UONOGXRCSA-O |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|