C35H32O2Si — CID 154441201
3-[2-[tert-butyl(diphenyl)silyl]ethynyl]-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one (PubChem CID 154441201) has the molecular formula C35H32O2Si and a molecular weight of 512.73 g/mol. Its IUPAC name is 3-[2-[tert-butyl(diphenyl)silyl]ethynyl]-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one.
| Compound Name | 3-[2-[tert-butyl(diphenyl)silyl]ethynyl]-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
|---|---|
| PubChem CID | 154441201 |
| Molecular Formula | C35H32O2Si |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 3-[2-[tert-butyl(diphenyl)silyl]ethynyl]-5,9,10,11-tetrahydronaphtho[7,6-c]isochromen-8-one |
| SMILES | CC(C)(C)[Si](C#Cc1ccc2c(c1)COc1cc3c(cc1-2)CCCC3=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H32O2Si/c1-35(2,3)38(28-12-6-4-7-13-28,29-14-8-5-9-15-29)20-19-25-17-18-30-27(21-25)24-37-34-23-31-26(22-32(30)34)11-10-16-33(31)36/h4-9,12-15,17-18,21-23H,10-11,16,24H2,1-3H3 |
| InChIKey | CGUWWTUMZJTZDW-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|