C14H25BrClNO2Si — CID 15444160
(2R,6R,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 15444160) has the molecular formula C14H25BrClNO2Si and a molecular weight of 382.80 g/mol. Its IUPAC name is (2R,6R,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R,6R,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 15444160 |
| Molecular Formula | C14H25BrClNO2Si |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | (2R,6R,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2[C@H](Br)C[C@@H](Cl)C(=O)N2C1 |
| InChI | InChI=1S/C14H25BrClNO2Si/c1-14(2,3)20(4,5)19-9-6-12-10(15)7-11(16)13(18)17(12)8-9/h9-12H,6-8H2,1-5H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | FTMCJRNBJDJPOX-KKOKHZNYSA-N |
| XLogP | 3.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|