C20H20F3N3 — CID 154441795
N-[(1-ethylimidazol-4-yl)methyl]-N-methyl-4-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 154441795) has the molecular formula C20H20F3N3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[(1-ethylimidazol-4-yl)methyl]-N-methyl-4-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | N-[(1-ethylimidazol-4-yl)methyl]-N-methyl-4-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 154441795 |
| Molecular Formula | C20H20F3N3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(1-ethylimidazol-4-yl)methyl]-N-methyl-4-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CCn1cnc(CN(C)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C20H20F3N3/c1-3-26-13-18(24-14-26)12-25(2)19-10-6-16(7-11-19)15-4-8-17(9-5-15)20(21,22)23/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | DHENTMBYNYFIPO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |