C21H26ClN4O4S2+ — CID 154441975
(4R,5S,6S)-3-[(3S,5S)-5-[(5-chloro-6-methylimidazo[5,1-b][1,3]thiazol-6-ium-2-yl)methyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154441975) has the molecular formula C21H26ClN4O4S2+ and a molecular weight of 498.05 g/mol. Its IUPAC name is (4R,5S,6S)-3-[(3S,5S)-5-[(5-chloro-6-methylimidazo[5,1-b][1,3]thiazol-6-ium-2-yl)methyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-3-[(3S,5S)-5-[(5-chloro-6-methylimidazo[5,1-b][1,3]thiazol-6-ium-2-yl)methyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154441975 |
| Molecular Formula | C21H26ClN4O4S2+ |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (4R,5S,6S)-3-[(3S,5S)-5-[(5-chloro-6-methylimidazo[5,1-b][1,3]thiazol-6-ium-2-yl)methyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](Cc4cn5c(Cl)[n+](C)cc5s4)C3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C21H25ClN4O4S2/c1-9-16-15(10(2)27)19(28)26(16)17(20(29)30)18(9)32-12-4-11(23-6-12)5-13-7-25-14(31-13)8-24(3)21(25)22/h7-12,15-16,23,27H,4-6H2,1-3H3/p+1/t9-,10-,11+,12+,15-,16-/m1/s1 |
| InChIKey | UUZYDWFEJFZCNF-ZNNLQBODSA-O |
| XLogP | 1.64 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|