C27H29N3O7S2 — CID 154442662
(5R,6R)-3-[4-(benzylamino)-4-oxobutyl]sulfanyl-6-[(1S)-1-hydroxypropyl]-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154442662) has the molecular formula C27H29N3O7S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is (5R,6R)-3-[4-(benzylamino)-4-oxobutyl]sulfanyl-6-[(1S)-1-hydroxypropyl]-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6R)-3-[4-(benzylamino)-4-oxobutyl]sulfanyl-6-[(1S)-1-hydroxypropyl]-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154442662 |
| Molecular Formula | C27H29N3O7S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | (5R,6R)-3-[4-(benzylamino)-4-oxobutyl]sulfanyl-6-[(1S)-1-hydroxypropyl]-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC[C@H](O)[C@@H]1C(=O)N2C(C(=O)O)=C(SCCCC(=O)NCc3ccccc3)S[C@]12Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H29N3O7S2/c1-2-20(31)22-24(33)29-23(25(34)35)26(38-14-6-9-21(32)28-16-18-7-4-3-5-8-18)39-27(22,29)15-17-10-12-19(13-11-17)30(36)37/h3-5,7-8,10-13,20,22,31H,2,6,9,14-16H2,1H3,(H,28,32)(H,34,35)/t20-,22+,27+/m0/s1 |
| InChIKey | QGHYJYYXSHTKQX-ZVUIFXONSA-N |
| XLogP | 3.89 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|