C20H25N9O5S3 — CID 154442761
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154442761) has the molecular formula C20H25N9O5S3 and a molecular weight of 567.68 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154442761 |
| Molecular Formula | C20H25N9O5S3 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C20H25N9O5S3/c1-3-4-5-6-34-25-12(11-9-36-19(21)22-11)15(30)23-13-16(31)29-14(18(32)33)10(7-35-17(13)29)8-37-20-24-26-27-28(20)2/h9,13,17H,3-8H2,1-2H3,(H2,21,22)(H,23,30)(H,32,33)/t13?,17-/m1/s1 |
| InChIKey | FXZHJVFDTLVITR-LRHAYUFXSA-N |
| XLogP | 0.69 |
| TPSA | 190.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|