C12H20O2 — CID 15444405
(2R)-2-heptyl-2,3-dihydropyran-4-one (PubChem CID 15444405) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R)-2-heptyl-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-heptyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 15444405 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2R)-2-heptyl-2,3-dihydropyran-4-one |
| SMILES | CCCCCCC[C@@H]1CC(=O)C=CO1 |
| InChI | InChI=1S/C12H20O2/c1-2-3-4-5-6-7-12-10-11(13)8-9-14-12/h8-9,12H,2-7,10H2,1H3/t12-/m1/s1 |
| InChIKey | XHZXWSKYXRYZML-GFCCVEGCSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|