About 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide
3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide (PubChem CID 154444541) has the molecular formula C9H6N2O2S2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
| PubChem CID | 154444541 |
| Molecular Formula | C9H6N2O2S2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(n2cccc2)c2sccc21 |
| InChI | InChI=1S/C9H6N2O2S2/c12-15(13)7-3-6-14-8(7)9(10-15)11-4-1-2-5-11/h1-6H |
| InChIKey | PBBHFZWZHXELTL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The IUPAC name of 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide (CID 154444541) is 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide.
What is the SMILES notation for 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The canonical SMILES for 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide is O=S1(=O)N=C(n2cccc2)c2sccc21.
What is the InChIKey of 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The InChIKey is PBBHFZWZHXELTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2S2/c12-15(13)7-3-6-14-8(7)9(10-15)11-4-1-2-5-11/h1-6H.
What are the key properties of 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide has a molecular weight of 238.29 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrol-1-ylthieno[2,3-d][1,2]thiazole 1,1-dioxide is sourced from PubChem (CID 154444541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).