C10H10N2O4S2 — CID 154445618
2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzenesulfonamide (PubChem CID 154445618) has the molecular formula C10H10N2O4S2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzenesulfonamide.
| Compound Name | 2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154445618 |
| Molecular Formula | C10H10N2O4S2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1CC1SC(=O)NC1=O |
| InChI | InChI=1S/C10H10N2O4S2/c11-18(15,16)8-4-2-1-3-6(8)5-7-9(13)12-10(14)17-7/h1-4,7H,5H2,(H2,11,15,16)(H,12,13,14) |
| InChIKey | ZVFRBKBDBYAFPY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|