C20H28O3 — CID 15444666
(2R,3R)-2,3-dicyclohexyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 15444666) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R,3R)-2,3-dicyclohexyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | (2R,3R)-2,3-dicyclohexyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 15444666 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2R,3R)-2,3-dicyclohexyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | O=C1C=CC2(C=C1)O[C@H](C1CCCCC1)[C@@H](C1CCCCC1)O2 |
| InChI | InChI=1S/C20H28O3/c21-17-11-13-20(14-12-17)22-18(15-7-3-1-4-8-15)19(23-20)16-9-5-2-6-10-16/h11-16,18-19H,1-10H2/t18-,19-/m1/s1 |
| InChIKey | PWUTXJRDHDIHMJ-RTBURBONSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |