C24H27NSi — CID 15444899
4,4-diphenyl-1-(2-phenylethyl)-1,4-azasilinane (PubChem CID 15444899) has the molecular formula C24H27NSi and a molecular weight of 357.57 g/mol. Its IUPAC name is 4,4-diphenyl-1-(2-phenylethyl)-1,4-azasilinane.
| Compound Name | 4,4-diphenyl-1-(2-phenylethyl)-1,4-azasilinane |
|---|---|
| PubChem CID | 15444899 |
| Molecular Formula | C24H27NSi |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4,4-diphenyl-1-(2-phenylethyl)-1,4-azasilinane |
| SMILES | c1ccc(CCN2CC[Si](c3ccccc3)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H27NSi/c1-4-10-22(11-5-1)16-17-25-18-20-26(21-19-25,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15H,16-21H2 |
| InChIKey | GLOUVJBTCAMIFH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|