C15H21N3O2 — CID 154449142
tert-butyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate (PubChem CID 154449142) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate |
|---|---|
| PubChem CID | 154449142 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NCC(c2ccccc2)CN1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,3)20-14(19)18-13-16-9-12(10-17-13)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | OJZHWIVQCMJORO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |