C20H30N2O3 — CID 154451082
[4-methyl-1-[3-methylbut-2-enyl(1-phenylethyl)amino]-1-oxopentan-2-yl]carbamic acid (PubChem CID 154451082) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is [4-methyl-1-[3-methylbut-2-enyl(1-phenylethyl)amino]-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [4-methyl-1-[3-methylbut-2-enyl(1-phenylethyl)amino]-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154451082 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [4-methyl-1-[3-methylbut-2-enyl(1-phenylethyl)amino]-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)=CCN(C(=O)C(CC(C)C)NC(=O)O)C(C)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-14(2)11-12-22(16(5)17-9-7-6-8-10-17)19(23)18(13-15(3)4)21-20(24)25/h6-11,15-16,18,21H,12-13H2,1-5H3,(H,24,25) |
| InChIKey | GXILYQAWWICQQG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|