About 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole
5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole (PubChem CID 154452715) has the molecular formula C24H22ClN5O2S2
and a molecular weight of 512.06 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 154452715 |
| Molecular Formula | C24H22ClN5O2S2 |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=S(=O)(c1c(Cl)nc2sccn12)n1c(N2CCN(Cc3ccccc3)CC2)cc2ccccc21 |
| InChI | InChI=1S/C24H22ClN5O2S2/c25-22-23(29-14-15-33-24(29)26-22)34(31,32)30-20-9-5-4-8-19(20)16-21(30)28-12-10-27(11-13-28)17-18-6-2-1-3-7-18/h1-9,14-16H,10-13,17H2 |
| InChIKey | RQUCIELGASHWRE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole (CID 154452715) is 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole is O=S(=O)(c1c(Cl)nc2sccn12)n1c(N2CCN(Cc3ccccc3)CC2)cc2ccccc21.
What is the InChIKey of 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole?
The InChIKey is RQUCIELGASHWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClN5O2S2/c25-22-23(29-14-15-33-24(29)26-22)34(31,32)30-20-9-5-4-8-19(20)16-21(30)28-12-10-27(11-13-28)17-18-6-2-1-3-7-18/h1-9,14-16H,10-13,17H2.
What are the key properties of 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole?
5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole has a molecular weight of 512.06 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-benzylpiperazin-1-yl)indol-1-yl]sulfonyl-6-chloroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 154452715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).