C10H4F4O4-2 — CID 154452747
2-[5-fluoro-2-(trifluoromethyl)phenyl]propanedioate (PubChem CID 154452747) has the molecular formula C10H4F4O4-2 and a molecular weight of 264.13 g/mol. Its IUPAC name is 2-[5-fluoro-2-(trifluoromethyl)phenyl]propanedioate.
| Compound Name | 2-[5-fluoro-2-(trifluoromethyl)phenyl]propanedioate |
|---|---|
| PubChem CID | 154452747 |
| Molecular Formula | C10H4F4O4-2 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-[5-fluoro-2-(trifluoromethyl)phenyl]propanedioate |
| SMILES | O=C([O-])C(C(=O)[O-])c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H6F4O4/c11-4-1-2-6(10(12,13)14)5(3-4)7(8(15)16)9(17)18/h1-3,7H,(H,15,16)(H,17,18)/p-2 |
| InChIKey | QSXKTACOTQJSLW-UHFFFAOYSA-L |
| XLogP | -0.57 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|