C26H33NO4 — CID 15445290
tert-butyl (2R,4R)-2-[(E,3R)-3-methyl-4-phenylmethoxybut-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15445290) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(E,3R)-3-methyl-4-phenylmethoxybut-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(E,3R)-3-methyl-4-phenylmethoxybut-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15445290 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(E,3R)-3-methyl-4-phenylmethoxybut-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H](/C=C/[C@H]1OC[C@@H](c2ccccc2)N1C(=O)OC(C)(C)C)COCc1ccccc1 |
| InChI | InChI=1S/C26H33NO4/c1-20(17-29-18-21-11-7-5-8-12-21)15-16-24-27(25(28)31-26(2,3)4)23(19-30-24)22-13-9-6-10-14-22/h5-16,20,23-24H,17-19H2,1-4H3/b16-15+/t20-,23+,24-/m1/s1 |
| InChIKey | PMEJXIYGRGRIFS-UWXGASMKSA-N |
| XLogP | 5.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|