About 4-diazoheptane
4-diazoheptane (PubChem CID 15445316) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 4-diazoheptane.
Molecular Properties
| Compound Name | 4-diazoheptane |
| PubChem CID | 15445316 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 4-diazoheptane |
| SMILES | CCCC(CCC)=[N+]=[N-] |
| InChI | InChI=1S/C7H14N2/c1-3-5-7(9-8)6-4-2/h3-6H2,1-2H3 |
| InChIKey | GMBSSKQHIDAWCV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazoheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazoheptane?
The IUPAC name of 4-diazoheptane (CID 15445316) is 4-diazoheptane.
What is the SMILES notation for 4-diazoheptane?
The canonical SMILES for 4-diazoheptane is CCCC(CCC)=[N+]=[N-].
What is the InChIKey of 4-diazoheptane?
The InChIKey is GMBSSKQHIDAWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-5-7(9-8)6-4-2/h3-6H2,1-2H3.
What are the key properties of 4-diazoheptane?
4-diazoheptane has a molecular weight of 126.20 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazoheptane is sourced from PubChem (CID 15445316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).