About 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine
2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine (PubChem CID 154453212) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine.
Molecular Properties
| Compound Name | 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine |
| PubChem CID | 154453212 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine |
| SMILES | CCC1=CC=C2Cc3ccccc3N=C2N1O |
| InChI | InChI=1S/C14H14N2O/c1-2-12-8-7-11-9-10-5-3-4-6-13(10)15-14(11)16(12)17/h3-8,17H,2,9H2,1H3 |
| InChIKey | DEYNAOKFJYKGIA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine?
The IUPAC name of 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine (CID 154453212) is 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine.
What is the SMILES notation for 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine?
The canonical SMILES for 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine is CCC1=CC=C2Cc3ccccc3N=C2N1O.
What is the InChIKey of 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine?
The InChIKey is DEYNAOKFJYKGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-2-12-8-7-11-9-10-5-3-4-6-13(10)15-14(11)16(12)17/h3-8,17H,2,9H2,1H3.
What are the key properties of 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine?
2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine has a molecular weight of 226.28 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-hydroxy-5H-benzo[b][1,8]naphthyridine is sourced from PubChem (CID 154453212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).