C30H22F6O4 — CID 154453271
methyl 4-[2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]phenyl]benzoate (PubChem CID 154453271) has the molecular formula C30H22F6O4 and a molecular weight of 560.49 g/mol. Its IUPAC name is methyl 4-[2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]phenyl]benzoate.
| Compound Name | methyl 4-[2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 154453271 |
| Molecular Formula | C30H22F6O4 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | methyl 4-[2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(COc3ccccc3C(F)(F)F)ccc2COc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H22F6O4/c1-38-28(37)21-14-12-20(13-15-21)23-16-19(17-39-26-8-4-2-6-24(26)29(31,32)33)10-11-22(23)18-40-27-9-5-3-7-25(27)30(34,35)36/h2-16H,17-18H2,1H3 |
| InChIKey | XISLYCICKADOFG-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |