C23H26F3N3O3S — CID 154453354
7-[5-(1-amino-2-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methyl-6,7-dihydroquinazoline-2,4-dione (PubChem CID 154453354) has the molecular formula C23H26F3N3O3S and a molecular weight of 481.54 g/mol. Its IUPAC name is 7-[5-(1-amino-2-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methyl-6,7-dihydroquinazoline-2,4-dione.
| Compound Name | 7-[5-(1-amino-2-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methyl-6,7-dihydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 154453354 |
| Molecular Formula | C23H26F3N3O3S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 7-[5-(1-amino-2-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methyl-6,7-dihydroquinazoline-2,4-dione |
| SMILES | CC1=c2c(c(=O)[nH]c(=O)n2C2CC2)=C(C(F)F)C(F)C1c1cc2c(s1)CCC(C(N)CO)C2 |
| InChI | InChI=1S/C23H26F3N3O3S/c1-9-16(15-7-11-6-10(13(27)8-30)2-5-14(11)33-15)19(24)17(21(25)26)18-20(9)29(12-3-4-12)23(32)28-22(18)31/h7,10,12-13,16,19,21,30H,2-6,8,27H2,1H3,(H,28,31,32) |
| InChIKey | IOIAZNDUCDTDLV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |