C23H28FN3O4S — CID 154453411
7-[4-(2-amino-1-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-6-fluoro-5-methoxy-8-methyl-6,7-dihydroquinazoline-2,4-dione (PubChem CID 154453411) has the molecular formula C23H28FN3O4S and a molecular weight of 461.56 g/mol. Its IUPAC name is 7-[4-(2-amino-1-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-6-fluoro-5-methoxy-8-methyl-6,7-dihydroquinazoline-2,4-dione.
| Compound Name | 7-[4-(2-amino-1-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-6-fluoro-5-methoxy-8-methyl-6,7-dihydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 154453411 |
| Molecular Formula | C23H28FN3O4S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 7-[4-(2-amino-1-hydroxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-6-fluoro-5-methoxy-8-methyl-6,7-dihydroquinazoline-2,4-dione |
| SMILES | COC1=c2c(=O)[nH]c(=O)n(C3CC3)c2=C(C)C(c2cc3c(s2)CCCC3C(O)CN)C1F |
| InChI | InChI=1S/C23H28FN3O4S/c1-10-17(16-8-13-12(14(28)9-25)4-3-5-15(13)32-16)19(24)21(31-2)18-20(10)27(11-6-7-11)23(30)26-22(18)29/h8,11-12,14,17,19,28H,3-7,9,25H2,1-2H3,(H,26,29,30) |
| InChIKey | PUKYLJFXUOWWEN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |