C16H21BrN2O — CID 154453903
5-bromo-3,6-diethyl-1-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2H-pyrazine (PubChem CID 154453903) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 5-bromo-3,6-diethyl-1-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2H-pyrazine.
| Compound Name | 5-bromo-3,6-diethyl-1-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2H-pyrazine |
|---|---|
| PubChem CID | 154453903 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 5-bromo-3,6-diethyl-1-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2H-pyrazine |
| SMILES | CCC1=NC(Br)=C(CC)N(C2CCCc3occc32)C1 |
| InChI | InChI=1S/C16H21BrN2O/c1-3-11-10-19(13(4-2)16(17)18-11)14-6-5-7-15-12(14)8-9-20-15/h8-9,14H,3-7,10H2,1-2H3 |
| InChIKey | FFCIJMAGDNBWFY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|