C10H18N4 — CID 154455409
4-methyl-2-methylimino-1,3,5,6,7,8-hexahydroquinazolin-4-amine (PubChem CID 154455409) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-methyl-2-methylimino-1,3,5,6,7,8-hexahydroquinazolin-4-amine.
| Compound Name | 4-methyl-2-methylimino-1,3,5,6,7,8-hexahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 154455409 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-methyl-2-methylimino-1,3,5,6,7,8-hexahydroquinazolin-4-amine |
| SMILES | C/N=C1\NC2=C(CCCC2)C(C)(N)N1 |
| InChI | InChI=1S/C10H18N4/c1-10(11)7-5-3-4-6-8(7)13-9(12-2)14-10/h3-6,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | ORYYODHYHJDGST-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|