C21H23NO3 — CID 15445662
1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one (PubChem CID 15445662) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 15445662 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)C1=NOC(COc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO3/c23-21(14-8-7-11-17-9-3-1-4-10-17)20-15-19(25-22-20)16-24-18-12-5-2-6-13-18/h1-6,9-10,12-13,19H,7-8,11,14-16H2 |
| InChIKey | HBXVWDBLJJTXOY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|