About 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one
1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one (PubChem CID 15445662) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one.
Molecular Properties
| Compound Name | 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one |
| PubChem CID | 15445662 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)C1=NOC(COc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO3/c23-21(14-8-7-11-17-9-3-1-4-10-17)20-15-19(25-22-20)16-24-18-12-5-2-6-13-18/h1-6,9-10,12-13,19H,7-8,11,14-16H2 |
| InChIKey | HBXVWDBLJJTXOY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one?
The IUPAC name of 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one (CID 15445662) is 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one.
What is the SMILES notation for 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one?
The canonical SMILES for 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one is O=C(CCCCc1ccccc1)C1=NOC(COc2ccccc2)C1.
What is the InChIKey of 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one?
The InChIKey is HBXVWDBLJJTXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c23-21(14-8-7-11-17-9-3-1-4-10-17)20-15-19(25-22-20)16-24-18-12-5-2-6-13-18/h1-6,9-10,12-13,19H,7-8,11,14-16H2.
What are the key properties of 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one?
1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one has a molecular weight of 337.42 g/mol, XLogP of 4.19, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(phenoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]-5-phenylpentan-1-one is sourced from PubChem (CID 15445662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).