About 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate
2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate (PubChem CID 154457133) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate |
| PubChem CID | 154457133 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCCCC1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-11-7-5-6-8-12(11)13(14)15-9-10-16(2,3)4/h12H,1,5-10H2,2-4H3 |
| InChIKey | SCJOSGXXYFZDCC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate (CID 154457133) is 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate is C=C1CCCCC1C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate?
The InChIKey is SCJOSGXXYFZDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2Si/c1-11-7-5-6-8-12(11)13(14)15-9-10-16(2,3)4/h12H,1,5-10H2,2-4H3.
What are the key properties of 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate?
2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate has a molecular weight of 240.42 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-methylidenecyclohexane-1-carboxylate is sourced from PubChem (CID 154457133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).