About N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide
N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 154457803) has the molecular formula C10H14N2O5
and a molecular weight of 242.23 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide |
| PubChem CID | 154457803 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | Cn1cc(C(=O)NOC[C@@H](O)CO)ccc1=O |
| InChI | InChI=1S/C10H14N2O5/c1-12-4-7(2-3-9(12)15)10(16)11-17-6-8(14)5-13/h2-4,8,13-14H,5-6H2,1H3,(H,11,16)/t8-/m0/s1 |
| InChIKey | STGKCIVNYDWZCP-QMMMGPOBSA-N |
| XLogP | -1.60 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide?
The IUPAC name of N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide (CID 154457803) is N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide.
What is the SMILES notation for N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide?
The canonical SMILES for N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide is Cn1cc(C(=O)NOC[C@@H](O)CO)ccc1=O.
What is the InChIKey of N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide?
The InChIKey is STGKCIVNYDWZCP-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H14N2O5/c1-12-4-7(2-3-9(12)15)10(16)11-17-6-8(14)5-13/h2-4,8,13-14H,5-6H2,1H3,(H,11,16)/t8-/m0/s1.
What are the key properties of N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide?
N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide has a molecular weight of 242.23 g/mol, XLogP of -1.60, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2,3-dihydroxypropoxy]-1-methyl-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 154457803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).