C19H29N — CID 154458299
[(10R,13R,14S)-10-methyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-13-yl]methanamine (PubChem CID 154458299) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is [(10R,13R,14S)-10-methyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-13-yl]methanamine.
| Compound Name | [(10R,13R,14S)-10-methyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-13-yl]methanamine |
|---|---|
| PubChem CID | 154458299 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | [(10R,13R,14S)-10-methyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-13-yl]methanamine |
| SMILES | C[C@]12C=CCCC1CCC1=C2CC[C@]2(CN)CCC[C@@H]12 |
| InChI | InChI=1S/C19H29N/c1-18-10-3-2-5-14(18)7-8-15-16(18)9-12-19(13-20)11-4-6-17(15)19/h3,10,14,17H,2,4-9,11-13,20H2,1H3/t14?,17-,18-,19-/m0/s1 |
| InChIKey | SCCVPEFIAKXNCX-CISDCURYSA-N |
| XLogP | 4.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|