About 1,3-diphenylazulene
1,3-diphenylazulene (PubChem CID 15445931) has the molecular formula C22H16
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,3-diphenylazulene.
Molecular Properties
| Compound Name | 1,3-diphenylazulene |
| PubChem CID | 15445931 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1,3-diphenylazulene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3cccccc2-3)cc1 |
| InChI | InChI=1S/C22H16/c1-4-10-17(11-5-1)21-16-22(18-12-6-2-7-13-18)20-15-9-3-8-14-19(20)21/h1-16H |
| InChIKey | YKIVKUKOVWMUOW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-diphenylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenylazulene?
The IUPAC name of 1,3-diphenylazulene (CID 15445931) is 1,3-diphenylazulene.
What is the SMILES notation for 1,3-diphenylazulene?
The canonical SMILES for 1,3-diphenylazulene is c1ccc(-c2cc(-c3ccccc3)c3cccccc2-3)cc1.
What is the InChIKey of 1,3-diphenylazulene?
The InChIKey is YKIVKUKOVWMUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16/c1-4-10-17(11-5-1)21-16-22(18-12-6-2-7-13-18)20-15-9-3-8-14-19(20)21/h1-16H.
What are the key properties of 1,3-diphenylazulene?
1,3-diphenylazulene has a molecular weight of 280.37 g/mol, XLogP of 6.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenylazulene is sourced from PubChem (CID 15445931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).