About N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline
N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline (PubChem CID 154459474) has the molecular formula C13H14F4N2O
and a molecular weight of 290.26 g/mol. Its IUPAC name is N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline |
| PubChem CID | 154459474 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline |
| SMILES | CCN(C[C@@H]1COC=N1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N2O/c1-2-19(6-11-7-20-8-18-11)12-4-9(13(15,16)17)3-10(14)5-12/h3-5,8,11H,2,6-7H2,1H3/t11-/m1/s1 |
| InChIKey | CJGKYRYIBIUKPO-LLVKDONJSA-N |
| XLogP | 3.10 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline?
The IUPAC name of N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline (CID 154459474) is N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline.
What is the SMILES notation for N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline?
The canonical SMILES for N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline is CCN(C[C@@H]1COC=N1)c1cc(F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline?
The InChIKey is CJGKYRYIBIUKPO-LLVKDONJSA-N. The full InChI is InChI=1S/C13H14F4N2O/c1-2-19(6-11-7-20-8-18-11)12-4-9(13(15,16)17)3-10(14)5-12/h3-5,8,11H,2,6-7H2,1H3/t11-/m1/s1.
What are the key properties of N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline?
N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline has a molecular weight of 290.26 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4R)-4,5-dihydro-1,3-oxazol-4-yl]methyl]-N-ethyl-3-fluoro-5-(trifluoromethyl)aniline is sourced from PubChem (CID 154459474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).