About 5-(difluoromethoxy)-1,3-thiazole
5-(difluoromethoxy)-1,3-thiazole (PubChem CID 154460414) has the molecular formula C4H3F2NOS
and a molecular weight of 151.14 g/mol. Its IUPAC name is 5-(difluoromethoxy)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-1,3-thiazole |
| PubChem CID | 154460414 |
| Molecular Formula | C4H3F2NOS |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 150.99 |
| IUPAC Name | 5-(difluoromethoxy)-1,3-thiazole |
| SMILES | FC(F)Oc1cncs1 |
| InChI | InChI=1S/C4H3F2NOS/c5-4(6)8-3-1-7-2-9-3/h1-2,4H |
| InChIKey | BASSWTNPKTUTCX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(difluoromethoxy)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-1,3-thiazole?
The IUPAC name of 5-(difluoromethoxy)-1,3-thiazole (CID 154460414) is 5-(difluoromethoxy)-1,3-thiazole.
What is the SMILES notation for 5-(difluoromethoxy)-1,3-thiazole?
The canonical SMILES for 5-(difluoromethoxy)-1,3-thiazole is FC(F)Oc1cncs1.
What is the InChIKey of 5-(difluoromethoxy)-1,3-thiazole?
The InChIKey is BASSWTNPKTUTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F2NOS/c5-4(6)8-3-1-7-2-9-3/h1-2,4H.
What are the key properties of 5-(difluoromethoxy)-1,3-thiazole?
5-(difluoromethoxy)-1,3-thiazole has a molecular weight of 151.14 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-1,3-thiazole is sourced from PubChem (CID 154460414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).