About 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline
4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline (PubChem CID 154461682) has the molecular formula C15H11ClF2N2
and a molecular weight of 292.72 g/mol. Its IUPAC name is 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline.
Molecular Properties
| Compound Name | 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline |
| PubChem CID | 154461682 |
| Molecular Formula | C15H11ClF2N2 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline |
| SMILES | CC1=C(Cl)c2c(F)cc(F)cc2N(c2ccccn2)C1 |
| InChI | InChI=1S/C15H11ClF2N2/c1-9-8-20(13-4-2-3-5-19-13)12-7-10(17)6-11(18)14(12)15(9)16/h2-7H,8H2,1H3 |
| InChIKey | ZAMNPEWQHJEVPK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline?
The IUPAC name of 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline (CID 154461682) is 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline.
What is the SMILES notation for 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline?
The canonical SMILES for 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline is CC1=C(Cl)c2c(F)cc(F)cc2N(c2ccccn2)C1.
What is the InChIKey of 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline?
The InChIKey is ZAMNPEWQHJEVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF2N2/c1-9-8-20(13-4-2-3-5-19-13)12-7-10(17)6-11(18)14(12)15(9)16/h2-7H,8H2,1H3.
What are the key properties of 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline?
4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline has a molecular weight of 292.72 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,7-difluoro-3-methyl-1-pyridin-2-yl-2H-quinoline is sourced from PubChem (CID 154461682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).