About 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide
1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide (PubChem CID 154461686) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide |
| PubChem CID | 154461686 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide |
| SMILES | NC(=O)N1CNc2c1cnc1ccccc21 |
| InChI | InChI=1S/C11H10N4O/c12-11(16)15-6-14-10-7-3-1-2-4-8(7)13-5-9(10)15/h1-5,14H,6H2,(H2,12,16) |
| InChIKey | OQERYUNTFHJTNO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide?
The IUPAC name of 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide (CID 154461686) is 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide.
What is the SMILES notation for 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide?
The canonical SMILES for 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide is NC(=O)N1CNc2c1cnc1ccccc21.
What is the InChIKey of 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide?
The InChIKey is OQERYUNTFHJTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c12-11(16)15-6-14-10-7-3-1-2-4-8(7)13-5-9(10)15/h1-5,14H,6H2,(H2,12,16).
What are the key properties of 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide?
1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide has a molecular weight of 214.23 g/mol, XLogP of 1.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroimidazo[4,5-c]quinoline-3-carboxamide is sourced from PubChem (CID 154461686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).