C11H5F4N2O2- — CID 154461777
1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 154461777) has the molecular formula C11H5F4N2O2- and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | 1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 154461777 |
| Molecular Formula | C11H5F4N2O2- |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | O=C([O-])c1cn(-c2ccc(F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C11H6F4N2O2/c12-6-1-3-7(4-2-6)17-5-8(10(18)19)9(16-17)11(13,14)15/h1-5H,(H,18,19)/p-1 |
| InChIKey | BNGSGWFULJJAJG-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |