C17H16N6S — CID 154463433
2,3-dimethyl-4-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine (PubChem CID 154463433) has the molecular formula C17H16N6S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2,3-dimethyl-4-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine.
| Compound Name | 2,3-dimethyl-4-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 154463433 |
| Molecular Formula | C17H16N6S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2,3-dimethyl-4-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine |
| SMILES | Cc1c(N)ccc(Nc2nc(-c3ccsc3)nc3cn[nH]c23)c1C |
| InChI | InChI=1S/C17H16N6S/c1-9-10(2)13(4-3-12(9)18)20-17-15-14(7-19-23-15)21-16(22-17)11-5-6-24-8-11/h3-8H,18H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | KLUOUKFMYFDFMM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|