C23H22N8S — CID 154463435
1-(1,3-benzothiazol-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 154463435) has the molecular formula C23H22N8S and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 154463435 |
| Molecular Formula | C23H22N8S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncnc4cnn(-c5nc6ccccc6s5)c34)cc2)CC1 |
| InChI | InChI=1S/C23H22N8S/c1-29-10-12-30(13-11-29)17-8-6-16(7-9-17)27-22-21-19(24-15-25-22)14-26-31(21)23-28-18-4-2-3-5-20(18)32-23/h2-9,14-15H,10-13H2,1H3,(H,24,25,27) |
| InChIKey | NGZLXIPZXFESEE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|