About 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one
7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one (PubChem CID 154463730) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one.
Molecular Properties
| Compound Name | 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one |
| PubChem CID | 154463730 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one |
| SMILES | Cc1ccn(CC(=O)c2cccc3c2C(=O)OC32CNC2)n1 |
| InChI | InChI=1S/C16H15N3O3/c1-10-5-6-19(18-10)7-13(20)11-3-2-4-12-14(11)15(21)22-16(12)8-17-9-16/h2-6,17H,7-9H2,1H3 |
| InChIKey | OGVKAFPLPDSNBD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one?
The IUPAC name of 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one (CID 154463730) is 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one.
What is the SMILES notation for 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one?
The canonical SMILES for 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one is Cc1ccn(CC(=O)c2cccc3c2C(=O)OC32CNC2)n1.
What is the InChIKey of 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one?
The InChIKey is OGVKAFPLPDSNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-10-5-6-19(18-10)7-13(20)11-3-2-4-12-14(11)15(21)22-16(12)8-17-9-16/h2-6,17H,7-9H2,1H3.
What are the key properties of 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one?
7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one has a molecular weight of 297.31 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(3-methylpyrazol-1-yl)acetyl]spiro[2-benzofuran-3,3'-azetidine]-1-one is sourced from PubChem (CID 154463730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).