About 1-(oxolan-3-yl)-1,6-naphthyridin-2-one
1-(oxolan-3-yl)-1,6-naphthyridin-2-one (PubChem CID 154465710) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-1,6-naphthyridin-2-one |
| PubChem CID | 154465710 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(oxolan-3-yl)-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2cnccc2n1C1CCOC1 |
| InChI | InChI=1S/C12H12N2O2/c15-12-2-1-9-7-13-5-3-11(9)14(12)10-4-6-16-8-10/h1-3,5,7,10H,4,6,8H2 |
| InChIKey | OUXLJVWWRJLTOI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxolan-3-yl)-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-1,6-naphthyridin-2-one?
The IUPAC name of 1-(oxolan-3-yl)-1,6-naphthyridin-2-one (CID 154465710) is 1-(oxolan-3-yl)-1,6-naphthyridin-2-one.
What is the SMILES notation for 1-(oxolan-3-yl)-1,6-naphthyridin-2-one?
The canonical SMILES for 1-(oxolan-3-yl)-1,6-naphthyridin-2-one is O=c1ccc2cnccc2n1C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)-1,6-naphthyridin-2-one?
The InChIKey is OUXLJVWWRJLTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-12-2-1-9-7-13-5-3-11(9)14(12)10-4-6-16-8-10/h1-3,5,7,10H,4,6,8H2.
What are the key properties of 1-(oxolan-3-yl)-1,6-naphthyridin-2-one?
1-(oxolan-3-yl)-1,6-naphthyridin-2-one has a molecular weight of 216.24 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-1,6-naphthyridin-2-one is sourced from PubChem (CID 154465710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).