About 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine
2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine (PubChem CID 154467408) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| PubChem CID | 154467408 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| SMILES | Nc1cnc2nc(N3CCCCC3)oc2c1 |
| InChI | InChI=1S/C11H14N4O/c12-8-6-9-10(13-7-8)14-11(16-9)15-4-2-1-3-5-15/h6-7H,1-5,12H2 |
| InChIKey | MISWUDDJJOOZLR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine (CID 154467408) is 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine is Nc1cnc2nc(N3CCCCC3)oc2c1.
What is the InChIKey of 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine?
The InChIKey is MISWUDDJJOOZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c12-8-6-9-10(13-7-8)14-11(16-9)15-4-2-1-3-5-15/h6-7H,1-5,12H2.
What are the key properties of 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine?
2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine has a molecular weight of 218.26 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 154467408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).