C11H14N4O — CID 154467408
2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine (PubChem CID 154467408) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine.
| Compound Name | 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 154467408 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-piperidin-1-yl-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| SMILES | Nc1cnc2nc(N3CCCCC3)oc2c1 |
| InChI | InChI=1S/C11H14N4O/c12-8-6-9-10(13-7-8)14-11(16-9)15-4-2-1-3-5-15/h6-7H,1-5,12H2 |
| InChIKey | MISWUDDJJOOZLR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |